C7H3F13O3S — CID 18945752
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptane-1-sulfonic acid (PubChem CID 18945752) has the molecular formula C7H3F13O3S and a molecular weight of 414.14 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptane-1-sulfonic acid.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptane-1-sulfonic acid |
|---|---|
| PubChem CID | 18945752 |
| Molecular Formula | C7H3F13O3S |
| Molecular Weight | 414.14 g/mol |
| Exact Mass | 413.96 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H3F13O3S/c8-2(9,1-24(21,22)23)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20/h1H2,(H,21,22,23) |
| InChIKey | AHKBHDQYKYNFLM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.14 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|