C16H8F21NO3S — CID 171930025
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecane-1-sulfonic acid;pyridine (PubChem CID 171930025) has the molecular formula C16H8F21NO3S and a molecular weight of 693.27 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecane-1-sulfonic acid;pyridine.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecane-1-sulfonic acid;pyridine |
|---|---|
| PubChem CID | 171930025 |
| Molecular Formula | C16H8F21NO3S |
| Molecular Weight | 693.27 g/mol |
| Exact Mass | 692.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecane-1-sulfonic acid;pyridine |
| SMILES | O=S(=O)(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccncc1 |
| InChI | InChI=1S/C11H3F21O3S.C5H5N/c12-2(13,1-36(33,34)35)3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)11(30,31)32;1-2-4-6-5-3-1/h1H2,(H,33,34,35);1-5H |
| InChIKey | HFTGXMADRJHMRK-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.27 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|