C18H16F26O8S2 — CID 87329595
ethane-1,1-diol;bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid) (PubChem CID 87329595) has the molecular formula C18H16F26O8S2 and a molecular weight of 918.40 g/mol. Its IUPAC name is ethane-1,1-diol;bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid).
| Compound Name | ethane-1,1-diol;bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid) |
|---|---|
| PubChem CID | 87329595 |
| Molecular Formula | C18H16F26O8S2 |
| Molecular Weight | 918.40 g/mol |
| Exact Mass | 917.99 |
| IUPAC Name | ethane-1,1-diol;bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid) |
| SMILES | CC(O)O.O=S(=O)(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=S(=O)(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/2C8H5F13O3S.C2H6O2/c2*9-3(10,1-2-25(22,23)24)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21;1-2(3)4/h2*1-2H2,(H,22,23,24);2-4H,1H3 |
| InChIKey | OMXVGHKKRPVSRM-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.40 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|