C18H16F18O8S2 — CID 87329635
benzene-1,4-diol;bis(3,3,4,4,5,5,6,6,6-nonafluorohexane-1-sulfonic acid) (PubChem CID 87329635) has the molecular formula C18H16F18O8S2 and a molecular weight of 766.42 g/mol. Its IUPAC name is benzene-1,4-diol;bis(3,3,4,4,5,5,6,6,6-nonafluorohexane-1-sulfonic acid).
| Compound Name | benzene-1,4-diol;bis(3,3,4,4,5,5,6,6,6-nonafluorohexane-1-sulfonic acid) |
|---|---|
| PubChem CID | 87329635 |
| Molecular Formula | C18H16F18O8S2 |
| Molecular Weight | 766.42 g/mol |
| Exact Mass | 766.00 |
| IUPAC Name | benzene-1,4-diol;bis(3,3,4,4,5,5,6,6,6-nonafluorohexane-1-sulfonic acid) |
| SMILES | O=S(=O)(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=S(=O)(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.Oc1ccc(O)cc1 |
| InChI | InChI=1S/2C6H5F9O3S.C6H6O2/c2*7-3(8,1-2-19(16,17)18)4(9,10)5(11,12)6(13,14)15;7-5-1-2-6(8)4-3-5/h2*1-2H2,(H,16,17,18);1-4,7-8H |
| InChIKey | NXVXFQGACOHOFX-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.42 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|