C5H2F10O2S — CID 166085431
1,1,1,2,2,3,3-heptafluoro-4-(trifluoromethylsulfonyl)butane (PubChem CID 166085431) has the molecular formula C5H2F10O2S and a molecular weight of 316.12 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-4-(trifluoromethylsulfonyl)butane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-4-(trifluoromethylsulfonyl)butane |
|---|---|
| PubChem CID | 166085431 |
| Molecular Formula | C5H2F10O2S |
| Molecular Weight | 316.12 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-4-(trifluoromethylsulfonyl)butane |
| SMILES | O=S(=O)(CC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H2F10O2S/c6-2(7,3(8,9)4(10,11)12)1-18(16,17)5(13,14)15/h1H2 |
| InChIKey | IVRXCJWTPSDLPB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.12 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|