C6H7F7O3S — CID 150640149
ethyl 2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate (PubChem CID 150640149) has the molecular formula C6H7F7O3S and a molecular weight of 292.17 g/mol. Its IUPAC name is ethyl 2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate.
| Compound Name | ethyl 2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 150640149 |
| Molecular Formula | C6H7F7O3S |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | ethyl 2,2,3,3,4,4,4-heptafluorobutane-1-sulfonate |
| SMILES | CCOS(=O)(=O)CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H7F7O3S/c1-2-16-17(14,15)3-4(7,8)5(9,10)6(11,12)13/h2-3H2,1H3 |
| InChIKey | IZSQJCRBGYTVEC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|