C10H10F12O6S2 — CID 157070240
2-(2,2,3,3,4,4-hexafluorobutylsulfonyloxy)ethyl 2,2,3,3,4,4-hexafluorobutane-1-sulfonate (PubChem CID 157070240) has the molecular formula C10H10F12O6S2 and a molecular weight of 518.29 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4-hexafluorobutylsulfonyloxy)ethyl 2,2,3,3,4,4-hexafluorobutane-1-sulfonate.
| Compound Name | 2-(2,2,3,3,4,4-hexafluorobutylsulfonyloxy)ethyl 2,2,3,3,4,4-hexafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 157070240 |
| Molecular Formula | C10H10F12O6S2 |
| Molecular Weight | 518.29 g/mol |
| Exact Mass | 517.97 |
| IUPAC Name | 2-(2,2,3,3,4,4-hexafluorobutylsulfonyloxy)ethyl 2,2,3,3,4,4-hexafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(CC(F)(F)C(F)(F)C(F)F)OCCOS(=O)(=O)CC(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H10F12O6S2/c11-5(12)9(19,20)7(15,16)3-29(23,24)27-1-2-28-30(25,26)4-8(17,18)10(21,22)6(13)14/h5-6H,1-4H2 |
| InChIKey | ACIOCTIPBFVWHZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|