C8H13F6N — CID 142573790
2,2,3,3,4,4-hexafluoro-N-methyl-N-propan-2-ylbutan-1-amine (PubChem CID 142573790) has the molecular formula C8H13F6N and a molecular weight of 237.19 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-N-methyl-N-propan-2-ylbutan-1-amine.
| Compound Name | 2,2,3,3,4,4-hexafluoro-N-methyl-N-propan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 142573790 |
| Molecular Formula | C8H13F6N |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-N-methyl-N-propan-2-ylbutan-1-amine |
| SMILES | CC(C)N(C)CC(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H13F6N/c1-5(2)15(3)4-7(11,12)8(13,14)6(9)10/h5-6H,4H2,1-3H3 |
| InChIKey | NJAMVVJIUQAFRX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|