C9H17F3O6S — CID 170900580
2-[2-(2-methoxyethoxy)ethoxy]ethyl 2,2,2-trifluoroethanesulfonate (PubChem CID 170900580) has the molecular formula C9H17F3O6S and a molecular weight of 310.29 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2,2,2-trifluoroethanesulfonate.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 170900580 |
| Molecular Formula | C9H17F3O6S |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2,2,2-trifluoroethanesulfonate |
| SMILES | COCCOCCOCCOS(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C9H17F3O6S/c1-15-2-3-16-4-5-17-6-7-18-19(13,14)8-9(10,11)12/h2-8H2,1H3 |
| InChIKey | WRTVFYZFRHAOSH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|