About 4-(2-methoxyethoxy)butyl trifluoromethanesulfonate
4-(2-methoxyethoxy)butyl trifluoromethanesulfonate (PubChem CID 139845363) has the molecular formula C8H15F3O5S
and a molecular weight of 280.26 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)butyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 4-(2-methoxyethoxy)butyl trifluoromethanesulfonate |
| PubChem CID | 139845363 |
| Molecular Formula | C8H15F3O5S |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 4-(2-methoxyethoxy)butyl trifluoromethanesulfonate |
| SMILES | COCCOCCCCOS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H15F3O5S/c1-14-6-7-15-4-2-3-5-16-17(12,13)8(9,10)11/h2-7H2,1H3 |
| InChIKey | DHVASBHDXQSKPV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methoxyethoxy)butyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxyethoxy)butyl trifluoromethanesulfonate?
The IUPAC name of 4-(2-methoxyethoxy)butyl trifluoromethanesulfonate (CID 139845363) is 4-(2-methoxyethoxy)butyl trifluoromethanesulfonate.
What is the SMILES notation for 4-(2-methoxyethoxy)butyl trifluoromethanesulfonate?
The canonical SMILES for 4-(2-methoxyethoxy)butyl trifluoromethanesulfonate is COCCOCCCCOS(=O)(=O)C(F)(F)F.
What is the InChIKey of 4-(2-methoxyethoxy)butyl trifluoromethanesulfonate?
The InChIKey is DHVASBHDXQSKPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3O5S/c1-14-6-7-15-4-2-3-5-16-17(12,13)8(9,10)11/h2-7H2,1H3.
What are the key properties of 4-(2-methoxyethoxy)butyl trifluoromethanesulfonate?
4-(2-methoxyethoxy)butyl trifluoromethanesulfonate has a molecular weight of 280.26 g/mol, XLogP of 1.30, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxyethoxy)butyl trifluoromethanesulfonate is sourced from PubChem (CID 139845363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).