About 5-bromopentyl trifluoromethanesulfonate
5-bromopentyl trifluoromethanesulfonate (PubChem CID 24975322) has the molecular formula C6H10BrF3O3S
and a molecular weight of 299.11 g/mol. Its IUPAC name is 5-bromopentyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 5-bromopentyl trifluoromethanesulfonate |
| PubChem CID | 24975322 |
| Molecular Formula | C6H10BrF3O3S |
| Molecular Weight | 299.11 g/mol |
| Exact Mass | 297.95 |
| IUPAC Name | 5-bromopentyl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCCCCCBr)C(F)(F)F |
| InChI | InChI=1S/C6H10BrF3O3S/c7-4-2-1-3-5-13-14(11,12)6(8,9)10/h1-5H2 |
| InChIKey | RCIBRQVRJJZMIM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.11 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 5-bromopentyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromopentyl trifluoromethanesulfonate?
The IUPAC name of 5-bromopentyl trifluoromethanesulfonate (CID 24975322) is 5-bromopentyl trifluoromethanesulfonate.
What is the SMILES notation for 5-bromopentyl trifluoromethanesulfonate?
The canonical SMILES for 5-bromopentyl trifluoromethanesulfonate is O=S(=O)(OCCCCCBr)C(F)(F)F.
What is the InChIKey of 5-bromopentyl trifluoromethanesulfonate?
The InChIKey is RCIBRQVRJJZMIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10BrF3O3S/c7-4-2-1-3-5-13-14(11,12)6(8,9)10/h1-5H2.
What are the key properties of 5-bromopentyl trifluoromethanesulfonate?
5-bromopentyl trifluoromethanesulfonate has a molecular weight of 299.11 g/mol, XLogP of 2.42, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromopentyl trifluoromethanesulfonate is sourced from PubChem (CID 24975322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).