C10H13F9O8S3 — CID 160915559
hept-6-enyl trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate (PubChem CID 160915559) has the molecular formula C10H13F9O8S3 and a molecular weight of 528.39 g/mol. Its IUPAC name is hept-6-enyl trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate.
| Compound Name | hept-6-enyl trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 160915559 |
| Molecular Formula | C10H13F9O8S3 |
| Molecular Weight | 528.39 g/mol |
| Exact Mass | 527.96 |
| IUPAC Name | hept-6-enyl trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | C=CCCCCCOS(=O)(=O)C(F)(F)F.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H13F3O3S.C2F6O5S2/c1-2-3-4-5-6-7-14-15(12,13)8(9,10)11;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h2H,1,3-7H2; |
| InChIKey | SRIWVXQEUVXFGP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|