C14H19F6O3- — CID 162508098
2-dec-9-enoxycarbonyl-1,1,1,3,3,3-hexafluoropropan-2-olate (PubChem CID 162508098) has the molecular formula C14H19F6O3- and a molecular weight of 349.29 g/mol. Its IUPAC name is 2-dec-9-enoxycarbonyl-1,1,1,3,3,3-hexafluoropropan-2-olate.
| Compound Name | 2-dec-9-enoxycarbonyl-1,1,1,3,3,3-hexafluoropropan-2-olate |
|---|---|
| PubChem CID | 162508098 |
| Molecular Formula | C14H19F6O3- |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2-dec-9-enoxycarbonyl-1,1,1,3,3,3-hexafluoropropan-2-olate |
| SMILES | C=CCCCCCCCCOC(=O)C([O-])(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H19F6O3/c1-2-3-4-5-6-7-8-9-10-23-11(21)12(22,13(15,16)17)14(18,19)20/h2H,1,3-10H2/q-1 |
| InChIKey | RRKYNOLMIKAZAI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|