C11H13F6O3- — CID 162509099
1,1,1,3,3,3-hexafluoro-2-hept-6-enoxycarbonylpropan-2-olate (PubChem CID 162509099) has the molecular formula C11H13F6O3- and a molecular weight of 307.21 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-hept-6-enoxycarbonylpropan-2-olate.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-hept-6-enoxycarbonylpropan-2-olate |
|---|---|
| PubChem CID | 162509099 |
| Molecular Formula | C11H13F6O3- |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-hept-6-enoxycarbonylpropan-2-olate |
| SMILES | C=CCCCCCOC(=O)C([O-])(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H13F6O3/c1-2-3-4-5-6-7-20-8(18)9(19,10(12,13)14)11(15,16)17/h2H,1,3-7H2/q-1 |
| InChIKey | YVXVCCJWAOZKKD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|