C3H2F7NO2S — CID 90745791
N,1,1,2,2,3,3-heptafluoropropane-1-sulfonamide (PubChem CID 90745791) has the molecular formula C3H2F7NO2S and a molecular weight of 249.11 g/mol. Its IUPAC name is N,1,1,2,2,3,3-heptafluoropropane-1-sulfonamide.
| Compound Name | N,1,1,2,2,3,3-heptafluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 90745791 |
| Molecular Formula | C3H2F7NO2S |
| Molecular Weight | 249.11 g/mol |
| Exact Mass | 248.97 |
| IUPAC Name | N,1,1,2,2,3,3-heptafluoropropane-1-sulfonamide |
| SMILES | O=S(=O)(NF)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C3H2F7NO2S/c4-1(5)2(6,7)3(8,9)14(12,13)11-10/h1,11H |
| InChIKey | VPZVCZKYXZDMOZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.11 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|