C10H9F6NO2S — CID 126638199
N-benzyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonamide (PubChem CID 126638199) has the molecular formula C10H9F6NO2S and a molecular weight of 321.24 g/mol. Its IUPAC name is N-benzyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonamide.
| Compound Name | N-benzyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 126638199 |
| Molecular Formula | C10H9F6NO2S |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | N-benzyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H9F6NO2S/c11-8(12)9(13,14)10(15,16)20(18,19)17-6-7-4-2-1-3-5-7/h1-5,8,17H,6H2 |
| InChIKey | UGHHASTVORXUHC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|