C12H15F3N2O6S — CID 70061830
(2S)-2-(benzylsulfamoylamino)propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 70061830) has the molecular formula C12H15F3N2O6S and a molecular weight of 372.32 g/mol. Its IUPAC name is (2S)-2-(benzylsulfamoylamino)propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-(benzylsulfamoylamino)propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70061830 |
| Molecular Formula | C12H15F3N2O6S |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | (2S)-2-(benzylsulfamoylamino)propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | C[C@H](NS(=O)(=O)NCc1ccccc1)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H14N2O4S.C2HF3O2/c1-8(10(13)14)12-17(15,16)11-7-9-5-3-2-4-6-9;3-2(4,5)1(6)7/h2-6,8,11-12H,7H2,1H3,(H,13,14);(H,6,7)/t8-;/m0./s1 |
| InChIKey | QXKCJPJEMXSRDK-QRPNPIFTSA-N |
| XLogP | 0.72 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |