C11H15N5O2S2 — CID 56886319
5-[1-(benzylsulfamoylamino)ethyl]-1,3,4-thiadiazol-2-amine (PubChem CID 56886319) has the molecular formula C11H15N5O2S2 and a molecular weight of 313.41 g/mol. Its IUPAC name is 5-[1-(benzylsulfamoylamino)ethyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[1-(benzylsulfamoylamino)ethyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 56886319 |
| Molecular Formula | C11H15N5O2S2 |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 5-[1-(benzylsulfamoylamino)ethyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CC(NS(=O)(=O)NCc1ccccc1)c1nnc(N)s1 |
| InChI | InChI=1S/C11H15N5O2S2/c1-8(10-14-15-11(12)19-10)16-20(17,18)13-7-9-5-3-2-4-6-9/h2-6,8,13,16H,7H2,1H3,(H2,12,15) |
| InChIKey | JNBCEZXAAWYXBA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |