C7H5F9O3S — CID 167685766
4,4,4-trifluoro-1-(1,1,2,2,3,3-hexafluoropropylsulfonyl)butan-2-one (PubChem CID 167685766) has the molecular formula C7H5F9O3S and a molecular weight of 340.16 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(1,1,2,2,3,3-hexafluoropropylsulfonyl)butan-2-one.
| Compound Name | 4,4,4-trifluoro-1-(1,1,2,2,3,3-hexafluoropropylsulfonyl)butan-2-one |
|---|---|
| PubChem CID | 167685766 |
| Molecular Formula | C7H5F9O3S |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 4,4,4-trifluoro-1-(1,1,2,2,3,3-hexafluoropropylsulfonyl)butan-2-one |
| SMILES | O=C(CC(F)(F)F)CS(=O)(=O)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H5F9O3S/c8-4(9)6(13,14)7(15,16)20(18,19)2-3(17)1-5(10,11)12/h4H,1-2H2 |
| InChIKey | RXOPWJZDHMKLEN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|