methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate

C7H5F9O4S — CID 53386603

IUPACmethyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate
SMILESCOC(=O)CS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C7H5F9O4S/c1-20-3(17)2-21(18,19)7(15,16)5(10,11)4(8,9)6(12,13)14/h2H2,1H3
InChIKeyVFIBJTDYUAOQLG-UHFFFAOYSA-N
MW356.16 g/mol
LogP2.00
Rot. Bonds5

About methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate

methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate (PubChem CID 53386603) has the molecular formula C7H5F9O4S and a molecular weight of 356.16 g/mol. Its IUPAC name is methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate.

Molecular Properties

Compound Namemethyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate
PubChem CID53386603
Molecular FormulaC7H5F9O4S
Molecular Weight356.16 g/mol
Exact Mass355.98
IUPAC Namemethyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate
SMILESCOC(=O)CS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C7H5F9O4S/c1-20-3(17)2-21(18,19)7(15,16)5(10,11)4(8,9)6(12,13)14/h2H2,1H3
InChIKeyVFIBJTDYUAOQLG-UHFFFAOYSA-N
XLogP2.00
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500356.16
LogP ≤ 52.00
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate?
The IUPAC name of methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate (CID 53386603) is methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate.
What is the SMILES notation for methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate?
The canonical SMILES for methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate is COC(=O)CS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.
What is the InChIKey of methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate?
The InChIKey is VFIBJTDYUAOQLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F9O4S/c1-20-3(17)2-21(18,19)7(15,16)5(10,11)4(8,9)6(12,13)14/h2H2,1H3.
What are the key properties of methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate?
methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate has a molecular weight of 356.16 g/mol, XLogP of 2.00, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate is sourced from PubChem (CID 53386603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).