C7H5F9O4S — CID 53386603
methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate (PubChem CID 53386603) has the molecular formula C7H5F9O4S and a molecular weight of 356.16 g/mol. Its IUPAC name is methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate.
| Compound Name | methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate |
|---|---|
| PubChem CID | 53386603 |
| Molecular Formula | C7H5F9O4S |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | methyl 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetate |
| SMILES | COC(=O)CS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F9O4S/c1-20-3(17)2-21(18,19)7(15,16)5(10,11)4(8,9)6(12,13)14/h2H2,1H3 |
| InChIKey | VFIBJTDYUAOQLG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|