C7F15O6S3- — CID 59440478
1-[bis(trifluoromethylsulfonyl)methylsulfonyl]-1,1,2,2,3,3,4,4,4-nonafluorobutane (PubChem CID 59440478) has the molecular formula C7F15O6S3- and a molecular weight of 561.24 g/mol. Its IUPAC name is 1-[bis(trifluoromethylsulfonyl)methylsulfonyl]-1,1,2,2,3,3,4,4,4-nonafluorobutane.
| Compound Name | 1-[bis(trifluoromethylsulfonyl)methylsulfonyl]-1,1,2,2,3,3,4,4,4-nonafluorobutane |
|---|---|
| PubChem CID | 59440478 |
| Molecular Formula | C7F15O6S3- |
| Molecular Weight | 561.24 g/mol |
| Exact Mass | 560.86 |
| IUPAC Name | 1-[bis(trifluoromethylsulfonyl)methylsulfonyl]-1,1,2,2,3,3,4,4,4-nonafluorobutane |
| SMILES | O=S(=O)([C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7F15O6S3/c8-2(9,4(12,13)14)3(10,11)5(15,16)29(23,24)1(30(25,26)6(17,18)19)31(27,28)7(20,21)22/q-1 |
| InChIKey | LMNVREMMIAYKIE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|