C8F18MgO12S6 — CID 171930698
magnesium bis(bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane) (PubChem CID 171930698) has the molecular formula C8F18MgO12S6 and a molecular weight of 846.75 g/mol. Its IUPAC name is magnesium bis(bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane).
| Compound Name | magnesium bis(bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane) |
|---|---|
| PubChem CID | 171930698 |
| Molecular Formula | C8F18MgO12S6 |
| Molecular Weight | 846.75 g/mol |
| Exact Mass | 845.73 |
| IUPAC Name | magnesium bis(bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane) |
| SMILES | O=S(=O)([C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)C(F)(F)F.O=S(=O)([C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)C(F)(F)F.[Mg+2] |
| InChI | InChI=1S/2C4F9O6S3.Mg/c2*5-2(6,7)20(14,15)1(21(16,17)3(8,9)10)22(18,19)4(11,12)13;/q2*-1;+2 |
| InChIKey | GRPCYZVALABSTE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 204.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.75 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|