C15H18F9NO6S3 — CID 158640296
bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane;1-butyl-3,4-dimethylpyridin-1-ium (PubChem CID 158640296) has the molecular formula C15H18F9NO6S3 and a molecular weight of 575.49 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane;1-butyl-3,4-dimethylpyridin-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane;1-butyl-3,4-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 158640296 |
| Molecular Formula | C15H18F9NO6S3 |
| Molecular Weight | 575.49 g/mol |
| Exact Mass | 575.02 |
| IUPAC Name | bis(trifluoromethylsulfonyl)methylsulfonyl-trifluoromethane;1-butyl-3,4-dimethylpyridin-1-ium |
| SMILES | CCCC[n+]1ccc(C)c(C)c1.O=S(=O)([C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H18N.C4F9O6S3/c1-4-5-7-12-8-6-10(2)11(3)9-12;5-2(6,7)20(14,15)1(21(16,17)3(8,9)10)22(18,19)4(11,12)13/h6,8-9H,4-5,7H2,1-3H3;/q+1;-1 |
| InChIKey | IAHGYVBBMORSOP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 106.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|