C25H46BrN — CID 86082407
3,4-dimethyl-1-octadecylpyridin-1-ium bromide (PubChem CID 86082407) has the molecular formula C25H46BrN and a molecular weight of 440.55 g/mol. Its IUPAC name is 3,4-dimethyl-1-octadecylpyridin-1-ium bromide.
| Compound Name | 3,4-dimethyl-1-octadecylpyridin-1-ium bromide |
|---|---|
| PubChem CID | 86082407 |
| Molecular Formula | C25H46BrN |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | 3,4-dimethyl-1-octadecylpyridin-1-ium bromide |
| SMILES | CCCCCCCCCCCCCCCCCC[n+]1ccc(C)c(C)c1.[Br-] |
| InChI | InChI=1S/C25H46N.BrH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21-26-22-20-24(2)25(3)23-26;/h20,22-23H,4-19,21H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | TZSOLILTHMQDQT-UHFFFAOYSA-M |
| XLogP | 4.86 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|