C11H18BF4N — CID 87942549
1-butyl-3,4-dimethylpyridin-1-ium tetrafluoroborate (PubChem CID 87942549) has the molecular formula C11H18BF4N and a molecular weight of 251.08 g/mol. Its IUPAC name is 1-butyl-3,4-dimethylpyridin-1-ium tetrafluoroborate.
| Compound Name | 1-butyl-3,4-dimethylpyridin-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 87942549 |
| Molecular Formula | C11H18BF4N |
| Molecular Weight | 251.08 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 1-butyl-3,4-dimethylpyridin-1-ium tetrafluoroborate |
| SMILES | CCCC[n+]1ccc(C)c(C)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C11H18N.BF4/c1-4-5-7-12-8-6-10(2)11(3)9-12;2-1(3,4)5/h6,8-9H,4-5,7H2,1-3H3;/q+1;-1 |
| InChIKey | IULWTCFENQTSPW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.08 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|