About 1-butyl-4-methylpyridin-1-ium;copper;tetrafluoroborate
1-butyl-4-methylpyridin-1-ium;copper;tetrafluoroborate (PubChem CID 87482027) has the molecular formula C10H16BCuF4N
and a molecular weight of 300.60 g/mol. Its IUPAC name is 1-butyl-4-methylpyridin-1-ium;copper;tetrafluoroborate.
Molecular Properties
| Compound Name | 1-butyl-4-methylpyridin-1-ium;copper;tetrafluoroborate |
| PubChem CID | 87482027 |
| Molecular Formula | C10H16BCuF4N |
| Molecular Weight | 300.60 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 1-butyl-4-methylpyridin-1-ium;copper;tetrafluoroborate |
| SMILES | CCCC[n+]1ccc(C)cc1.F[B-](F)(F)F.[Cu] |
| InChI | InChI=1S/C10H16N.BF4.Cu/c1-3-4-7-11-8-5-10(2)6-9-11;2-1(3,4)5;/h5-6,8-9H,3-4,7H2,1-2H3;;/q+1;-1; |
| InChIKey | XVWBVEAWITVQQE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.60 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-4-methylpyridin-1-ium;copper;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-methylpyridin-1-ium;copper;tetrafluoroborate?
The IUPAC name of 1-butyl-4-methylpyridin-1-ium;copper;tetrafluoroborate (CID 87482027) is 1-butyl-4-methylpyridin-1-ium;copper;tetrafluoroborate.
What is the SMILES notation for 1-butyl-4-methylpyridin-1-ium;copper;tetrafluoroborate?
The canonical SMILES for 1-butyl-4-methylpyridin-1-ium;copper;tetrafluoroborate is CCCC[n+]1ccc(C)cc1.F[B-](F)(F)F.[Cu].
What is the InChIKey of 1-butyl-4-methylpyridin-1-ium;copper;tetrafluoroborate?
The InChIKey is XVWBVEAWITVQQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N.BF4.Cu/c1-3-4-7-11-8-5-10(2)6-9-11;2-1(3,4)5;/h5-6,8-9H,3-4,7H2,1-2H3;;/q+1;-1;.
What are the key properties of 1-butyl-4-methylpyridin-1-ium;copper;tetrafluoroborate?
1-butyl-4-methylpyridin-1-ium;copper;tetrafluoroborate has a molecular weight of 300.60 g/mol, XLogP of 3.38, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-methylpyridin-1-ium;copper;tetrafluoroborate is sourced from PubChem (CID 87482027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).