C17H26BF8N — CID 87860640
4-methyl-1-nonylpyridin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide (PubChem CID 87860640) has the molecular formula C17H26BF8N and a molecular weight of 407.20 g/mol. Its IUPAC name is 4-methyl-1-nonylpyridin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide.
| Compound Name | 4-methyl-1-nonylpyridin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide |
|---|---|
| PubChem CID | 87860640 |
| Molecular Formula | C17H26BF8N |
| Molecular Weight | 407.20 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 4-methyl-1-nonylpyridin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide |
| SMILES | CCCCCCCCC[n+]1ccc(C)cc1.F[B-](F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H26N.C2BF8/c1-3-4-5-6-7-8-9-12-16-13-10-15(2)11-14-16;4-1(5,2(6,7)8)3(9,10)11/h10-11,13-14H,3-9,12H2,1-2H3;/q+1;-1 |
| InChIKey | CPYXGWFGUIPJHP-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.20 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|