C15H26F6NP — CID 158312080
4-methyl-1-nonylpyridin-1-ium hexafluorophosphate (PubChem CID 158312080) has the molecular formula C15H26F6NP and a molecular weight of 365.34 g/mol. Its IUPAC name is 4-methyl-1-nonylpyridin-1-ium hexafluorophosphate.
| Compound Name | 4-methyl-1-nonylpyridin-1-ium hexafluorophosphate |
|---|---|
| PubChem CID | 158312080 |
| Molecular Formula | C15H26F6NP |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 4-methyl-1-nonylpyridin-1-ium hexafluorophosphate |
| SMILES | CCCCCCCCC[n+]1ccc(C)cc1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C15H26N.F6P/c1-3-4-5-6-7-8-9-12-16-13-10-15(2)11-14-16;1-7(2,3,4,5)6/h10-11,13-14H,3-9,12H2,1-2H3;/q+1;-1 |
| InChIKey | GNULJJPSTFNSLV-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|