C17H23F6N2P — CID 177370087
1-heptyl-4-pyridin-4-ylpyridin-1-ium hexafluorophosphate (PubChem CID 177370087) has the molecular formula C17H23F6N2P and a molecular weight of 400.35 g/mol. Its IUPAC name is 1-heptyl-4-pyridin-4-ylpyridin-1-ium hexafluorophosphate.
| Compound Name | 1-heptyl-4-pyridin-4-ylpyridin-1-ium hexafluorophosphate |
|---|---|
| PubChem CID | 177370087 |
| Molecular Formula | C17H23F6N2P |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-heptyl-4-pyridin-4-ylpyridin-1-ium hexafluorophosphate |
| SMILES | CCCCCCC[n+]1ccc(-c2ccncc2)cc1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C17H23N2.F6P/c1-2-3-4-5-6-13-19-14-9-17(10-15-19)16-7-11-18-12-8-16;1-7(2,3,4,5)6/h7-12,14-15H,2-6,13H2,1H3;/q+1;-1 |
| InChIKey | PHIZXEMVEQFUMV-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|