C27H30F12N4P2 — CID 11115178
4-pyridin-4-yl-1-[7-(4-pyridin-4-ylpyridin-1-ium-1-yl)heptyl]pyridin-1-ium dihexafluorophosphate (PubChem CID 11115178) has the molecular formula C27H30F12N4P2 and a molecular weight of 700.49 g/mol. Its IUPAC name is 4-pyridin-4-yl-1-[7-(4-pyridin-4-ylpyridin-1-ium-1-yl)heptyl]pyridin-1-ium dihexafluorophosphate.
| Compound Name | 4-pyridin-4-yl-1-[7-(4-pyridin-4-ylpyridin-1-ium-1-yl)heptyl]pyridin-1-ium dihexafluorophosphate |
|---|---|
| PubChem CID | 11115178 |
| Molecular Formula | C27H30F12N4P2 |
| Molecular Weight | 700.49 g/mol |
| Exact Mass | 700.18 |
| IUPAC Name | 4-pyridin-4-yl-1-[7-(4-pyridin-4-ylpyridin-1-ium-1-yl)heptyl]pyridin-1-ium dihexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F.c1cc(-c2cc[n+](CCCCCCC[n+]3ccc(-c4ccncc4)cc3)cc2)ccn1 |
| InChI | InChI=1S/C27H30N4.2F6P/c1(2-4-18-30-20-10-26(11-21-30)24-6-14-28-15-7-24)3-5-19-31-22-12-27(13-23-31)25-8-16-29-17-9-25;2*1-7(2,3,4,5)6/h6-17,20-23H,1-5,18-19H2;;/q+2;2*-1 |
| InChIKey | CXBZXRAMTPKPNJ-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 33.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.49 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|