C18H30Br4N2+2 — CID 174105893
1-[4-(3,4-dimethylpyridin-1-ium-1-yl)butyl]-3,4-dimethylpyridin-1-ium;tetrahydrobromide (PubChem CID 174105893) has the molecular formula C18H30Br4N2+2 and a molecular weight of 594.07 g/mol. Its IUPAC name is 1-[4-(3,4-dimethylpyridin-1-ium-1-yl)butyl]-3,4-dimethylpyridin-1-ium;tetrahydrobromide.
| Compound Name | 1-[4-(3,4-dimethylpyridin-1-ium-1-yl)butyl]-3,4-dimethylpyridin-1-ium;tetrahydrobromide |
|---|---|
| PubChem CID | 174105893 |
| Molecular Formula | C18H30Br4N2+2 |
| Molecular Weight | 594.07 g/mol |
| Exact Mass | 589.91 |
| IUPAC Name | 1-[4-(3,4-dimethylpyridin-1-ium-1-yl)butyl]-3,4-dimethylpyridin-1-ium;tetrahydrobromide |
| SMILES | Br.Br.Br.Br.Cc1cc[n+](CCCC[n+]2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C18H26N2.4BrH/c1-15-7-11-19(13-17(15)3)9-5-6-10-20-12-8-16(2)18(4)14-20;;;;/h7-8,11-14H,5-6,9-10H2,1-4H3;4*1H/q+2;;;; |
| InChIKey | LLTMZLXAXLIKQE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.07 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|