C30H34N2+2 — CID 58338513
1-[5-[2-[5-(3,4-dimethylpyridin-1-ium-1-yl)pent-1-ynyl]phenyl]pent-4-ynyl]-3,5-dimethylpyridin-1-ium (PubChem CID 58338513) has the molecular formula C30H34N2+2 and a molecular weight of 422.62 g/mol. Its IUPAC name is 1-[5-[2-[5-(3,4-dimethylpyridin-1-ium-1-yl)pent-1-ynyl]phenyl]pent-4-ynyl]-3,5-dimethylpyridin-1-ium.
| Compound Name | 1-[5-[2-[5-(3,4-dimethylpyridin-1-ium-1-yl)pent-1-ynyl]phenyl]pent-4-ynyl]-3,5-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 58338513 |
| Molecular Formula | C30H34N2+2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 1-[5-[2-[5-(3,4-dimethylpyridin-1-ium-1-yl)pent-1-ynyl]phenyl]pent-4-ynyl]-3,5-dimethylpyridin-1-ium |
| SMILES | Cc1cc(C)c[n+](CCCC#Cc2ccccc2C#CCCC[n+]2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C30H34N2/c1-25-21-26(2)23-32(22-25)19-12-6-8-14-30-16-10-9-15-29(30)13-7-5-11-18-31-20-17-27(3)28(4)24-31/h9-10,15-17,20-24H,5-6,11-12,18-19H2,1-4H3/q+2 |
| InChIKey | BTULTSKWOQLJKJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|