C17H26Br2N2+2 — CID 126960264
1-[3-(3,5-dimethylpyridin-1-ium-1-yl)propyl]-3,5-dimethylpyridin-1-ium;dihydrobromide (PubChem CID 126960264) has the molecular formula C17H26Br2N2+2 and a molecular weight of 418.22 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyridin-1-ium-1-yl)propyl]-3,5-dimethylpyridin-1-ium;dihydrobromide.
| Compound Name | 1-[3-(3,5-dimethylpyridin-1-ium-1-yl)propyl]-3,5-dimethylpyridin-1-ium;dihydrobromide |
|---|---|
| PubChem CID | 126960264 |
| Molecular Formula | C17H26Br2N2+2 |
| Molecular Weight | 418.22 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 1-[3-(3,5-dimethylpyridin-1-ium-1-yl)propyl]-3,5-dimethylpyridin-1-ium;dihydrobromide |
| SMILES | Br.Br.Cc1cc(C)c[n+](CCC[n+]2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C17H24N2.2BrH/c1-14-8-15(2)11-18(10-14)6-5-7-19-12-16(3)9-17(4)13-19;;/h8-13H,5-7H2,1-4H3;2*1H/q+2;; |
| InChIKey | QKALTYLGXSQQQP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.22 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|