C15H24Br2N+ — CID 53315265
3,5-dibromo-1-decylpyridin-1-ium (PubChem CID 53315265) has the molecular formula C15H24Br2N+ and a molecular weight of 378.17 g/mol. Its IUPAC name is 3,5-dibromo-1-decylpyridin-1-ium.
| Compound Name | 3,5-dibromo-1-decylpyridin-1-ium |
|---|---|
| PubChem CID | 53315265 |
| Molecular Formula | C15H24Br2N+ |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 3,5-dibromo-1-decylpyridin-1-ium |
| SMILES | CCCCCCCCCC[n+]1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C15H24Br2N/c1-2-3-4-5-6-7-8-9-10-18-12-14(16)11-15(17)13-18/h11-13H,2-10H2,1H3/q+1 |
| InChIKey | ICIPFLJBHJBMQJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|