C18H28Br2N2+2 — CID 126960257
1-[4-(3,5-dimethylpyridin-1-ium-1-yl)butyl]-3,5-dimethylpyridin-1-ium;dihydrobromide (PubChem CID 126960257) has the molecular formula C18H28Br2N2+2 and a molecular weight of 432.24 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpyridin-1-ium-1-yl)butyl]-3,5-dimethylpyridin-1-ium;dihydrobromide.
| Compound Name | 1-[4-(3,5-dimethylpyridin-1-ium-1-yl)butyl]-3,5-dimethylpyridin-1-ium;dihydrobromide |
|---|---|
| PubChem CID | 126960257 |
| Molecular Formula | C18H28Br2N2+2 |
| Molecular Weight | 432.24 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 1-[4-(3,5-dimethylpyridin-1-ium-1-yl)butyl]-3,5-dimethylpyridin-1-ium;dihydrobromide |
| SMILES | Br.Br.Cc1cc(C)c[n+](CCCC[n+]2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C18H26N2.2BrH/c1-15-9-16(2)12-19(11-15)7-5-6-8-20-13-17(3)10-18(4)14-20;;/h9-14H,5-8H2,1-4H3;2*1H/q+2;; |
| InChIKey | BBKDMOLNFPUGMN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|