C22H34N2O3+2 — CID 24742174
1-[2-[2-[2-[2-(3,5-dimethylpyridin-1-ium-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-3,5-dimethylpyridin-1-ium (PubChem CID 24742174) has the molecular formula C22H34N2O3+2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-(3,5-dimethylpyridin-1-ium-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-3,5-dimethylpyridin-1-ium.
| Compound Name | 1-[2-[2-[2-[2-(3,5-dimethylpyridin-1-ium-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-3,5-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 24742174 |
| Molecular Formula | C22H34N2O3+2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 1-[2-[2-[2-[2-(3,5-dimethylpyridin-1-ium-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-3,5-dimethylpyridin-1-ium |
| SMILES | Cc1cc(C)c[n+](CCOCCOCCOCC[n+]2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C22H34N2O3/c1-19-13-20(2)16-23(15-19)5-7-25-9-11-27-12-10-26-8-6-24-17-21(3)14-22(4)18-24/h13-18H,5-12H2,1-4H3/q+2 |
| InChIKey | HILRDQXWNCJHBO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 35.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|