C20H30Br2N2O3 — CID 72720592
3-methyl-1-[2-[2-[2-[2-(3-methylpyridin-1-ium-1-yl)ethoxy]ethoxy]ethoxy]ethyl]pyridin-1-ium dibromide (PubChem CID 72720592) has the molecular formula C20H30Br2N2O3 and a molecular weight of 506.28 g/mol. Its IUPAC name is 3-methyl-1-[2-[2-[2-[2-(3-methylpyridin-1-ium-1-yl)ethoxy]ethoxy]ethoxy]ethyl]pyridin-1-ium dibromide.
| Compound Name | 3-methyl-1-[2-[2-[2-[2-(3-methylpyridin-1-ium-1-yl)ethoxy]ethoxy]ethoxy]ethyl]pyridin-1-ium dibromide |
|---|---|
| PubChem CID | 72720592 |
| Molecular Formula | C20H30Br2N2O3 |
| Molecular Weight | 506.28 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | 3-methyl-1-[2-[2-[2-[2-(3-methylpyridin-1-ium-1-yl)ethoxy]ethoxy]ethoxy]ethyl]pyridin-1-ium dibromide |
| SMILES | Cc1ccc[n+](CCOCCOCCOCC[n+]2cccc(C)c2)c1.[Br-].[Br-] |
| InChI | InChI=1S/C20H30N2O3.2BrH/c1-19-5-3-7-21(17-19)9-11-23-13-15-25-16-14-24-12-10-22-8-4-6-20(2)18-22;;/h3-8,17-18H,9-16H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | KRVQRVRUHWYGGA-UHFFFAOYSA-L |
| XLogP | -4.36 |
| TPSA | 35.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.28 |
| LogP ≤ 5 | -4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|