C20H30Br2N2O5 — CID 72720591
[1-[2-[2-[2-[2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]ethoxy]ethoxy]ethoxy]ethyl]pyridin-1-ium-3-yl]methanol dibromide (PubChem CID 72720591) has the molecular formula C20H30Br2N2O5 and a molecular weight of 538.28 g/mol. Its IUPAC name is [1-[2-[2-[2-[2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]ethoxy]ethoxy]ethoxy]ethyl]pyridin-1-ium-3-yl]methanol dibromide.
| Compound Name | [1-[2-[2-[2-[2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]ethoxy]ethoxy]ethoxy]ethyl]pyridin-1-ium-3-yl]methanol dibromide |
|---|---|
| PubChem CID | 72720591 |
| Molecular Formula | C20H30Br2N2O5 |
| Molecular Weight | 538.28 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | [1-[2-[2-[2-[2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]ethoxy]ethoxy]ethoxy]ethyl]pyridin-1-ium-3-yl]methanol dibromide |
| SMILES | OCc1ccc[n+](CCOCCOCCOCC[n+]2cccc(CO)c2)c1.[Br-].[Br-] |
| InChI | InChI=1S/C20H30N2O5.2BrH/c23-17-19-3-1-5-21(15-19)7-9-25-11-13-27-14-12-26-10-8-22-6-2-4-20(16-22)18-24;;/h1-6,15-16,23-24H,7-14,17-18H2;2*1H/q+2;;/p-2 |
| InChIKey | BJOMBAQBIONQNR-UHFFFAOYSA-L |
| XLogP | -6.00 |
| TPSA | 75.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.28 |
| LogP ≤ 5 | -6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|