C16H20Br2N4O3 — CID 11962149
(NE)-N-[[1-[2-[2-[3-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]ethoxy]ethyl]pyridin-1-ium-3-yl]methylidene]hydroxylamine dibromide (PubChem CID 11962149) has the molecular formula C16H20Br2N4O3 and a molecular weight of 476.17 g/mol. Its IUPAC name is (NE)-N-[[1-[2-[2-[3-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]ethoxy]ethyl]pyridin-1-ium-3-yl]methylidene]hydroxylamine dibromide.
| Compound Name | (NE)-N-[[1-[2-[2-[3-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]ethoxy]ethyl]pyridin-1-ium-3-yl]methylidene]hydroxylamine dibromide |
|---|---|
| PubChem CID | 11962149 |
| Molecular Formula | C16H20Br2N4O3 |
| Molecular Weight | 476.17 g/mol |
| Exact Mass | 473.99 |
| IUPAC Name | (NE)-N-[[1-[2-[2-[3-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]ethoxy]ethyl]pyridin-1-ium-3-yl]methylidene]hydroxylamine dibromide |
| SMILES | O/N=C/c1ccc[n+](CCOCC[n+]2cccc(/C=N/O)c2)c1.[Br-].[Br-] |
| InChI | InChI=1S/C16H18N4O3.2BrH/c21-17-11-15-3-1-5-19(13-15)7-9-23-10-8-20-6-2-4-16(14-20)12-18-22;;/h1-6,11-14H,7-10H2;2*1H/b17-11+,18-12+;; |
| InChIKey | SXPAODYQOMFVDN-SNTCFBDDSA-N |
| XLogP | -5.40 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.17 |
| LogP ≤ 5 | -5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|