C11H11ClN2OS — CID 45484604
(NE)-N-[[1-(thiophen-2-ylmethyl)pyridin-1-ium-3-yl]methylidene]hydroxylamine chloride (PubChem CID 45484604) has the molecular formula C11H11ClN2OS and a molecular weight of 254.74 g/mol. Its IUPAC name is (NE)-N-[[1-(thiophen-2-ylmethyl)pyridin-1-ium-3-yl]methylidene]hydroxylamine chloride.
| Compound Name | (NE)-N-[[1-(thiophen-2-ylmethyl)pyridin-1-ium-3-yl]methylidene]hydroxylamine chloride |
|---|---|
| PubChem CID | 45484604 |
| Molecular Formula | C11H11ClN2OS |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | (NE)-N-[[1-(thiophen-2-ylmethyl)pyridin-1-ium-3-yl]methylidene]hydroxylamine chloride |
| SMILES | O/N=C/c1ccc[n+](Cc2cccs2)c1.[Cl-] |
| InChI | InChI=1S/C11H10N2OS.ClH/c14-12-7-10-3-1-5-13(8-10)9-11-4-2-6-15-11;/h1-8H,9H2;1H/b12-7+; |
| InChIKey | LCAMFDFSJKIJQB-RRAJOLSVSA-N |
| XLogP | -1.10 |
| TPSA | 36.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|