C10H16N3O+ — CID 5167663
N-[[1-[2-(dimethylamino)ethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine (PubChem CID 5167663) has the molecular formula C10H16N3O+ and a molecular weight of 194.26 g/mol. Its IUPAC name is N-[[1-[2-(dimethylamino)ethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine.
| Compound Name | N-[[1-[2-(dimethylamino)ethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 5167663 |
| Molecular Formula | C10H16N3O+ |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | N-[[1-[2-(dimethylamino)ethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine |
| SMILES | CN(C)CC[n+]1ccc(C=NO)cc1 |
| InChI | InChI=1S/C10H15N3O/c1-12(2)7-8-13-5-3-10(4-6-13)9-11-14/h3-6,9H,7-8H2,1-2H3/p+1 |
| InChIKey | JUOUHLJTXUKSQL-UHFFFAOYSA-O |
| XLogP | 0.34 |
| TPSA | 39.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|