C15H19N3O+2 — CID 135765102
(NZ)-N-[[1-[3-(4-methylpyridin-1-ium-1-yl)propyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine (PubChem CID 135765102) has the molecular formula C15H19N3O+2 and a molecular weight of 257.34 g/mol. Its IUPAC name is (NZ)-N-[[1-[3-(4-methylpyridin-1-ium-1-yl)propyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[1-[3-(4-methylpyridin-1-ium-1-yl)propyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135765102 |
| Molecular Formula | C15H19N3O+2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | (NZ)-N-[[1-[3-(4-methylpyridin-1-ium-1-yl)propyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine |
| SMILES | Cc1cc[n+](CCC[n+]2ccc(/C=N\O)cc2)cc1 |
| InChI | InChI=1S/C15H18N3O/c1-14-3-9-17(10-4-14)7-2-8-18-11-5-15(6-12-18)13-16-19/h3-6,9-13H,2,7-8H2,1H3/q+1/p+1 |
| InChIKey | SCQPIVNNERDGNI-UHFFFAOYSA-O |
| XLogP | 1.47 |
| TPSA | 40.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|