C15H16Br2N4O — CID 135540945
1-[3-[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-carbonitrile dibromide (PubChem CID 135540945) has the molecular formula C15H16Br2N4O and a molecular weight of 428.13 g/mol. Its IUPAC name is 1-[3-[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-carbonitrile dibromide.
| Compound Name | 1-[3-[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-carbonitrile dibromide |
|---|---|
| PubChem CID | 135540945 |
| Molecular Formula | C15H16Br2N4O |
| Molecular Weight | 428.13 g/mol |
| Exact Mass | 425.97 |
| IUPAC Name | 1-[3-[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-carbonitrile dibromide |
| SMILES | N#Cc1cc[n+](CCC[n+]2ccc(/C=N/O)cc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C15H15N4O.2BrH/c16-12-14-2-8-18(9-3-14)6-1-7-19-10-4-15(5-11-19)13-17-20;;/h2-5,8-11,13H,1,6-7H2;2*1H/q+1;;/p-1 |
| InChIKey | ILGCMEGAPBEGTG-UHFFFAOYSA-M |
| XLogP | -4.96 |
| TPSA | 64.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.13 |
| LogP ≤ 5 | -4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|