C14H16BrN4O2+ — CID 137093036
(NE)-N-[[1-[2-[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]ethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine bromide (PubChem CID 137093036) has the molecular formula C14H16BrN4O2+ and a molecular weight of 352.21 g/mol. Its IUPAC name is (NE)-N-[[1-[2-[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]ethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine bromide.
| Compound Name | (NE)-N-[[1-[2-[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]ethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine bromide |
|---|---|
| PubChem CID | 137093036 |
| Molecular Formula | C14H16BrN4O2+ |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | (NE)-N-[[1-[2-[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]ethyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine bromide |
| SMILES | O/N=C/c1cc[n+](CC[n+]2ccc(/C=N/O)cc2)cc1.[Br-] |
| InChI | InChI=1S/C14H14N4O2.BrH/c19-15-11-13-1-5-17(6-2-13)9-10-18-7-3-14(4-8-18)12-16-20;/h1-8,11-12H,9-10H2;1H/p+1 |
| InChIKey | RRKVZVSNXCEDBP-UHFFFAOYSA-O |
| XLogP | -2.42 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|