C20H28Br2N4O2 — CID 135878482
(NE)-N-[[1-[8-[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]octyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine dibromide (PubChem CID 135878482) has the molecular formula C20H28Br2N4O2 and a molecular weight of 516.28 g/mol. Its IUPAC name is (NE)-N-[[1-[8-[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]octyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine dibromide.
| Compound Name | (NE)-N-[[1-[8-[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]octyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine dibromide |
|---|---|
| PubChem CID | 135878482 |
| Molecular Formula | C20H28Br2N4O2 |
| Molecular Weight | 516.28 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | (NE)-N-[[1-[8-[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]octyl]pyridin-1-ium-4-yl]methylidene]hydroxylamine dibromide |
| SMILES | O/N=C/c1cc[n+](CCCCCCCC[n+]2ccc(/C=N/O)cc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C20H26N4O2.2BrH/c25-21-17-19-7-13-23(14-8-19)11-5-3-1-2-4-6-12-24-15-9-20(10-16-24)18-22-26;;/h7-10,13-18H,1-6,11-12H2;2*1H |
| InChIKey | NAWPLMXXRNEIKB-UHFFFAOYSA-N |
| XLogP | -3.07 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.28 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|