C8H11IN2O — CID 137086779
(NE)-N-[(1-ethylpyridin-1-ium-4-yl)methylidene]hydroxylamine iodide (PubChem CID 137086779) has the molecular formula C8H11IN2O and a molecular weight of 278.09 g/mol. Its IUPAC name is (NE)-N-[(1-ethylpyridin-1-ium-4-yl)methylidene]hydroxylamine iodide.
| Compound Name | (NE)-N-[(1-ethylpyridin-1-ium-4-yl)methylidene]hydroxylamine iodide |
|---|---|
| PubChem CID | 137086779 |
| Molecular Formula | C8H11IN2O |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | (NE)-N-[(1-ethylpyridin-1-ium-4-yl)methylidene]hydroxylamine iodide |
| SMILES | CC[n+]1ccc(/C=N/O)cc1.[I-] |
| InChI | InChI=1S/C8H10N2O.HI/c1-2-10-5-3-8(4-6-10)7-9-11;/h3-7H,2H2,1H3;1H |
| InChIKey | CYJFNVCDSBDCMF-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 36.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|