C9H12BrN2O+ — CID 136745960
N-[[1-(3-bromopropyl)pyridin-1-ium-4-yl]methylidene]hydroxylamine (PubChem CID 136745960) has the molecular formula C9H12BrN2O+ and a molecular weight of 244.11 g/mol. Its IUPAC name is N-[[1-(3-bromopropyl)pyridin-1-ium-4-yl]methylidene]hydroxylamine.
| Compound Name | N-[[1-(3-bromopropyl)pyridin-1-ium-4-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 136745960 |
| Molecular Formula | C9H12BrN2O+ |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | N-[[1-(3-bromopropyl)pyridin-1-ium-4-yl]methylidene]hydroxylamine |
| SMILES | ON=Cc1cc[n+](CCCBr)cc1 |
| InChI | InChI=1S/C9H11BrN2O/c10-4-1-5-12-6-2-9(3-7-12)8-11-13/h2-3,6-8H,1,4-5H2/p+1 |
| InChIKey | FDSQMJINZRSVPW-UHFFFAOYSA-O |
| XLogP | 1.57 |
| TPSA | 36.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|