C22H28Br2N4 — CID 19745607
1-[10-(4-cyanopyridin-1-ium-1-yl)decyl]pyridin-1-ium-4-carbonitrile dibromide (PubChem CID 19745607) has the molecular formula C22H28Br2N4 and a molecular weight of 508.30 g/mol. Its IUPAC name is 1-[10-(4-cyanopyridin-1-ium-1-yl)decyl]pyridin-1-ium-4-carbonitrile dibromide.
| Compound Name | 1-[10-(4-cyanopyridin-1-ium-1-yl)decyl]pyridin-1-ium-4-carbonitrile dibromide |
|---|---|
| PubChem CID | 19745607 |
| Molecular Formula | C22H28Br2N4 |
| Molecular Weight | 508.30 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | 1-[10-(4-cyanopyridin-1-ium-1-yl)decyl]pyridin-1-ium-4-carbonitrile dibromide |
| SMILES | N#Cc1cc[n+](CCCCCCCCCC[n+]2ccc(C#N)cc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C22H28N4.2BrH/c23-19-21-9-15-25(16-10-21)13-7-5-3-1-2-4-6-8-14-26-17-11-22(20-24)12-18-26;;/h9-12,15-18H,1-8,13-14H2;2*1H/q+2;;/p-2 |
| InChIKey | SBYIIDYRZAEVPM-UHFFFAOYSA-L |
| XLogP | -2.17 |
| TPSA | 55.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.30 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|