C17H20N4+2 — CID 139483169
[(1Z,3E)-3-cyanopenta-1,3-dienyl]-[4-(4-cyanopyridin-1-ium-1-yl)butyl]-methylideneazanium (PubChem CID 139483169) has the molecular formula C17H20N4+2 and a molecular weight of 280.38 g/mol. Its IUPAC name is [(1Z,3E)-3-cyanopenta-1,3-dienyl]-[4-(4-cyanopyridin-1-ium-1-yl)butyl]-methylideneazanium.
| Compound Name | [(1Z,3E)-3-cyanopenta-1,3-dienyl]-[4-(4-cyanopyridin-1-ium-1-yl)butyl]-methylideneazanium |
|---|---|
| PubChem CID | 139483169 |
| Molecular Formula | C17H20N4+2 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | [(1Z,3E)-3-cyanopenta-1,3-dienyl]-[4-(4-cyanopyridin-1-ium-1-yl)butyl]-methylideneazanium |
| SMILES | C=[N+](/C=C\C(C#N)=C/C)CCCC[n+]1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H20N4/c1-3-16(14-18)6-11-20(2)9-4-5-10-21-12-7-17(15-19)8-13-21/h3,6-8,11-13H,2,4-5,9-10H2,1H3/q+2/b11-6-,16-3+ |
| InChIKey | ILKAEEGEBPEIED-AABAKTMMSA-N |
| XLogP | 2.32 |
| TPSA | 54.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|