C13H9Cl2N2+ — CID 12671949
1-[(2,6-dichlorophenyl)methyl]pyridin-1-ium-4-carbonitrile (PubChem CID 12671949) has the molecular formula C13H9Cl2N2+ and a molecular weight of 264.14 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]pyridin-1-ium-4-carbonitrile.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]pyridin-1-ium-4-carbonitrile |
|---|---|
| PubChem CID | 12671949 |
| Molecular Formula | C13H9Cl2N2+ |
| Molecular Weight | 264.14 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]pyridin-1-ium-4-carbonitrile |
| SMILES | N#Cc1cc[n+](Cc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C13H9Cl2N2/c14-12-2-1-3-13(15)11(12)9-17-6-4-10(8-16)5-7-17/h1-7H,9H2/q+1 |
| InChIKey | QPSCDEQFANAGNW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.14 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|